ChemNet > CAS > 98555-71-6 5-(2,5-Dichlorophenyl)-1H-tetrazole
98555-71-6 5-(2,5-Dichlorophenyl)-1H-tetrazole
produktnavn |
5-(2,5-Dichlorophenyl)-1H-tetrazole |
Engelsk navn |
5-(2,5-Dichlorophenyl)-1H-tetrazole;5-(2,5-dichlorophenyl)-2H-tetrazole |
Molekylær Formel |
C7H4Cl2N4 |
Molekylvekt |
215.0395 |
InChI |
InChI=1/C7H4Cl2N4/c8-4-1-2-6(9)5(3-4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
CAS-nummer |
98555-71-6 |
Molecular Structure |
|
Tetthet |
1.574g/cm3 |
Kokepunkt |
401.9°C at 760 mmHg |
Brytningsindeks |
1.641 |
Flammepunktet |
229.1°C |
Damptrykk |
1.14E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|