ChemNet > CAS > 99-21-8 N-(4-amino-5-methoxy-2-methylphenyl)benzamide
99-21-8 N-(4-amino-5-methoxy-2-methylphenyl)benzamide
produktnavn |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
Engelsk navn |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide; Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-; 4'-Amino-5'-methoxy-2'-methylbenzanilide; 4-amino-5-methoxy-2-methyl-N-phenylbenzamide; Fast Violet Base B; FAST VIOLER B BASE |
Molekylær Formel |
C15H16N2O2 |
Molekylvekt |
256.2997 |
InChI |
InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
CAS-nummer |
99-21-8 |
EINECS |
202-740-1 |
Molecular Structure |
|
Tetthet |
1.215g/cm3 |
Smeltepunkt |
185℃ |
Kokepunkt |
384.7°C at 760 mmHg |
Brytningsindeks |
1.646 |
Flammepunktet |
186.5°C |
Damptrykk |
4.01E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|