ChemNet > CAS > 10047-28-6 butyl thioglycolate
10047-28-6 butyl thioglycolate
| Nazwa produktu: |
butyl thioglycolate |
| Angielska nazwa |
butyl thioglycolate; |
| MF |
C6H12O2S |
| Masie cząsteczkowej |
148.2233 |
| InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
| Nr CAS |
10047-28-6 |
| EINECS |
233-156-5 |
| Struktury molekularnej |
|
| Gęstość |
1.088g/cm3 |
| Temperatura wrzenia |
220.125°C at 760 mmHg |
| Współczynnik załamania |
1.491 |
| Temperatura zapłonu |
86.929°C |
| Ciśnienie pary |
0.024mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
