ChemNet > CAS > 10342-85-5 4-Piperidinoacetophenone
10342-85-5 4-Piperidinoacetophenone
| Nazwa produktu: |
4-Piperidinoacetophenone |
| Angielska nazwa |
4-Piperidinoacetophenone; N-(4-Acetylphenyl)piperidine; 1-[4-(piperidin-1-yl)phenyl]ethanone; 4'-PIPERIDINOACETOPHENONE |
| MF |
C13H17NO |
| Masie cząsteczkowej |
203.2802 |
| InChI |
InChI=1/C13H17NO/c1-11(15)12-5-7-13(8-6-12)14-9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| Nr CAS |
10342-85-5 |
| EINECS |
233-746-2 |
| Struktury molekularnej |
|
| Gęstość |
1.052g/cm3 |
| Temperatura topnienia |
84-90℃ |
| Temperatura wrzenia |
357.8°C at 760 mmHg |
| Współczynnik załamania |
1.545 |
| Temperatura zapłonu |
140.2°C |
| Ciśnienie pary |
2.66E-05mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
