ChemNet > CAS > 104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
Nazwa produktu: |
2-Chloro-6-fluoro-3-methylbenzaldehyde |
Angielska nazwa |
2-Chloro-6-fluoro-3-methylbenzaldehyde; 2-Chloro-6-fluoro-m-tolualdehyde |
MF |
C8H6ClFO |
Masie cząsteczkowej |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-4H,1H3 |
Nr CAS |
104451-99-2 |
Struktury molekularnej |
|
Gęstość |
1.292g/cm3 |
Temperatura topnienia |
30-33℃ |
Temperatura wrzenia |
225.1°C at 760 mmHg |
Współczynnik załamania |
1.552 |
Temperatura zapłonu |
89.9°C |
Ciśnienie pary |
0.0882mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|