1073-23-0 2,6-Lutidine-N-oxide
Nazwa produktu: |
2,6-Lutidine-N-oxide |
Angielska nazwa |
2,6-Lutidine-N-oxide; 2,6-Dimethylpyridine N-oxide; 2,6-Lutidine N-oxide; LutidineNoxide; 2,6-dimethylpyridine 1-oxide; 2,6-dimethyl-1-oxo-1,2-dihydropyridinium |
MF |
C7H10NO |
Masie cząsteczkowej |
124.1599 |
InChI |
InChI=1/C7H10NO/c1-6-4-3-5-7(2)8(6)9/h3-6H,1-2H3/q+1 |
Nr CAS |
1073-23-0 |
EINECS |
214-025-1 |
Struktury molekularnej |
|
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|