1073-29-6 2-Hydroxythioanisole
Nazwa produktu: |
2-Hydroxythioanisole |
Angielska nazwa |
2-Hydroxythioanisole; 2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
MF |
C7H8OS |
Masie cząsteczkowej |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
Nr CAS |
1073-29-6 |
EINECS |
214-027-2 |
Struktury molekularnej |
|
Gęstość |
1.19g/cm3 |
Temperatura wrzenia |
206.1°C at 760 mmHg |
Współczynnik załamania |
1.613 |
Temperatura zapłonu |
108°C |
Ciśnienie pary |
0.168mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|