1119-46-6 5-Chlorovaleric acid
Nazwa produktu: |
5-Chlorovaleric acid |
Angielska nazwa |
5-Chlorovaleric acid; 214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
MF |
C5H9ClO2 |
Masie cząsteczkowej |
136.5768 |
InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
Nr CAS |
1119-46-6 |
EINECS |
214-279-3 |
Struktury molekularnej |
|
Gęstość |
1.166g/cm3 |
Temperatura topnienia |
18-20℃ |
Temperatura wrzenia |
230.9°C at 760 mmHg |
Współczynnik załamania |
1.452 |
Temperatura zapłonu |
93.4°C |
Ciśnienie pary |
0.0227mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|