1119-60-4 6-heptenoic acid
Nazwa produktu: |
6-heptenoic acid |
Angielska nazwa |
6-heptenoic acid; Hept-6-enoic acid |
MF |
C7H12O2 |
Masie cząsteczkowej |
128.169 |
InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9) |
Nr CAS |
1119-60-4 |
EINECS |
214-283-5 |
Struktury molekularnej |
|
Gęstość |
0.957g/cm3 |
Temperatura wrzenia |
226°C at 760 mmHg |
Współczynnik załamania |
1.447 |
Temperatura zapłonu |
113.3°C |
Ciśnienie pary |
0.0305mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|