ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
| Nazwa produktu: |
methyl 4-cyanobenzoate |
| Angielska nazwa |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
| MF |
C9H7NO2 |
| Masie cząsteczkowej |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| Nr CAS |
1129-35-7 |
| EINECS |
214-443-4 |
| Struktury molekularnej |
|
| Gęstość |
1.18g/cm3 |
| Temperatura topnienia |
62℃ |
| Temperatura wrzenia |
274.9°C at 760 mmHg |
| Współczynnik załamania |
1.535 |
| Temperatura zapłonu |
131.2°C |
| Ciśnienie pary |
0.00526mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
