ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
| Nazwa produktu: |
3,5-Dibromobenzeneboronic acid |
| Angielska nazwa |
3,5-Dibromobenzeneboronic acid; 3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
| MF |
C6H5BBr2O2 |
| Masie cząsteczkowej |
279.7217 |
| InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| Nr CAS |
117695-55-3 |
| Struktury molekularnej |
|
| Gęstość |
2.09g/cm3 |
| Temperatura topnienia |
300℃ |
| Temperatura wrzenia |
382.8°C at 760 mmHg |
| Współczynnik załamania |
1.651 |
| Temperatura zapłonu |
185.3°C |
| Ciśnienie pary |
1.52E-06mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
