ChemNet > CAS > 121219-12-3 4-n-Pentylbenzeneboronic acid
121219-12-3 4-n-Pentylbenzeneboronic acid
| Nazwa produktu: |
4-n-Pentylbenzeneboronic acid |
| Angielska nazwa |
4-n-Pentylbenzeneboronic acid; 4-n-Amylbenzeneboronic acid; 4-n-Pentylphenylboronic acid; (4-pentylphenyl)boronic acid; 4-Pentylbenzeneboronic acid |
| MF |
C11H17BO2 |
| Masie cząsteczkowej |
192.0625 |
| InChI |
InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
| Nr CAS |
121219-12-3 |
| Struktury molekularnej |
|
| Gęstość |
1.01g/cm3 |
| Temperatura wrzenia |
328°C at 760 mmHg |
| Współczynnik załamania |
1.509 |
| Temperatura zapłonu |
152.2°C |
| Ciśnienie pary |
7.85E-05mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
