ChemNet > CAS > 126771-41-3 4-(Bromomethyl)phenoxyacetic acid
126771-41-3 4-(Bromomethyl)phenoxyacetic acid
Nazwa produktu: |
4-(Bromomethyl)phenoxyacetic acid |
Angielska nazwa |
4-(Bromomethyl)phenoxyacetic acid; |
MF |
C9H9BrO3 |
Masie cząsteczkowej |
245.07 |
InChI |
InChI=1/C9H9BrO3/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
Nr CAS |
126771-41-3 |
Struktury molekularnej |
|
Gęstość |
1.59g/cm3 |
Temperatura wrzenia |
363°C at 760 mmHg |
Współczynnik załamania |
1.587 |
Temperatura zapłonu |
173.3°C |
Ciśnienie pary |
6.63E-06mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|