13029-09-9 2,2'-Dibromobiphenyl
Nazwa produktu: |
2,2'-Dibromobiphenyl |
Angielska nazwa |
2,2'-Dibromobiphenyl; 2,2-Dibromophenyl; 2,2-Dibromobiphenyl; 2,2'-dibromodiphenyl; 2,2'-Dibromo-1,1'-Biphenyl |
MF |
C12H8Br2 |
Masie cząsteczkowej |
311.9999 |
InChI |
InChI=1/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
Nr CAS |
13029-09-9 |
Struktury molekularnej |
|
Gęstość |
1.667g/cm3 |
Temperatura topnienia |
79℃ |
Temperatura wrzenia |
332.9°C at 760 mmHg |
Współczynnik załamania |
1.625 |
Temperatura zapłonu |
180°C |
Ciśnienie pary |
0.000274mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|