ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
Nazwa produktu: |
3-Iodophenylacetonitrile |
Angielska nazwa |
3-Iodophenylacetonitrile; 3-Iodobenzyl cyanide |
MF |
C8H6IN |
Masie cząsteczkowej |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
Nr CAS |
130723-54-5 |
Struktury molekularnej |
|
Gęstość |
1.764g/cm3 |
Temperatura wrzenia |
308.6°C at 760 mmHg |
Współczynnik załamania |
1.624 |
Temperatura zapłonu |
140.4°C |
Ciśnienie pary |
0.000674mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|