ChemNet > CAS > 13078-04-1 DL-Anabasine
13078-04-1 DL-Anabasine
| Nazwa produktu: |
DL-Anabasine |
| Angielska nazwa |
DL-Anabasine; 2-Pyridin-3-ylpiperidine; Neonicotine~2-(3-Pyridyl)piperidine; 3-piperidin-2-ylpyridine; 3-(piperidin-2-yl)pyridine hydrochloride (1:1); 3-(2-piperidyl)pyridine; 3-(piperidin-2-yl)pyridine |
| MF |
C10H14N2 |
| Masie cząsteczkowej |
162.2316 |
| InChI |
InChI=1/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
| Nr CAS |
13078-04-1 |
| EINECS |
207-791-3 |
| Struktury molekularnej |
|
| Gęstość |
1.014g/cm3 |
| Temperatura topnienia |
9℃ |
| Temperatura wrzenia |
271°C at 760 mmHg |
| Współczynnik załamania |
1.524 |
| Temperatura zapłonu |
93.3°C |
| Ciśnienie pary |
0.00662mmHg at 25°C |
| Symbole zagrożenia |
 T:Toxic;
|
| Kody ryzyka |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
