ChemNet > CAS > 13194-67-7 4-fluoro-2-iodotoluene
13194-67-7 4-fluoro-2-iodotoluene
| Nazwa produktu: |
4-fluoro-2-iodotoluene |
| Angielska nazwa |
4-fluoro-2-iodotoluene; 4-Fluoro-2-iodo-1-methylbenzene |
| MF |
C7H6FI |
| Masie cząsteczkowej |
236.0254 |
| InChI |
InChI=1/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| Nr CAS |
13194-67-7 |
| EINECS |
236-153-7 |
| Struktury molekularnej |
|
| Gęstość |
1.788g/cm3 |
| Temperatura wrzenia |
205.1°C at 760 mmHg |
| Współczynnik załamania |
1.58 |
| Temperatura zapłonu |
81°C |
| Ciśnienie pary |
0.364mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
