132-86-5 1,3-Dihydroxynaphthalene
Nazwa produktu: |
1,3-Dihydroxynaphthalene |
Angielska nazwa |
1,3-Dihydroxynaphthalene; 1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
MF |
C10H8O2 |
Masie cząsteczkowej |
160.1693 |
InChI |
InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
Nr CAS |
132-86-5 |
EINECS |
205-079-7 |
Struktury molekularnej |
|
Gęstość |
1.33g/cm3 |
Temperatura topnienia |
123-126℃ |
Temperatura wrzenia |
361.5°C at 760 mmHg |
Współczynnik załamania |
1.725 |
Temperatura zapłonu |
185.5°C |
Ciśnienie pary |
9.93E-06mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|