ChemNet > CAS > 132-86-5 1,3-Dihydroxynaphthalene
132-86-5 1,3-Dihydroxynaphthalene
| Nazwa produktu: |
1,3-Dihydroxynaphthalene |
| Angielska nazwa |
1,3-Dihydroxynaphthalene; 1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
| MF |
C10H8O2 |
| Masie cząsteczkowej |
160.1693 |
| InChI |
InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
| Nr CAS |
132-86-5 |
| EINECS |
205-079-7 |
| Struktury molekularnej |
|
| Gęstość |
1.33g/cm3 |
| Temperatura topnienia |
123-126℃ |
| Temperatura wrzenia |
361.5°C at 760 mmHg |
| Współczynnik załamania |
1.725 |
| Temperatura zapłonu |
185.5°C |
| Ciśnienie pary |
9.93E-06mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
