ChemNet > CAS > 135145-90-3 2,5-Dichlorobenzeneboronic acid
135145-90-3 2,5-Dichlorobenzeneboronic acid
Nazwa produktu: |
2,5-Dichlorobenzeneboronic acid |
Angielska nazwa |
2,5-Dichlorobenzeneboronic acid; 2,5-Dichlorophenylboronic acid |
MF |
C6H5BCl2O2 |
Masie cząsteczkowej |
190.8197 |
InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
Nr CAS |
135145-90-3 |
Struktury molekularnej |
|
Gęstość |
1.47g/cm3 |
Temperatura topnienia |
150℃ |
Temperatura wrzenia |
343.6°C at 760 mmHg |
Współczynnik załamania |
1.577 |
Temperatura zapłonu |
161.6°C |
Ciśnienie pary |
2.65E-05mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|