ChemNet > CAS > 13524-04-4 1-(2-Chlorophenyl)ethanol
13524-04-4 1-(2-Chlorophenyl)ethanol
Nazwa produktu: |
1-(2-Chlorophenyl)ethanol |
Angielska nazwa |
1-(2-Chlorophenyl)ethanol; 2-Chloro-alpha-methylbenzyl alcohol; (1S)-1-(2-chlorophenyl)ethanol; (1R)-1-(2-chlorophenyl)ethanol |
MF |
C8H9ClO |
Masie cząsteczkowej |
156.6095 |
InChI |
InChI=1/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m1/s1 |
Nr CAS |
13524-04-4 |
EINECS |
236-868-4 |
Struktury molekularnej |
|
Gęstość |
1.182g/cm3 |
Temperatura wrzenia |
231.4°C at 760 mmHg |
Współczynnik załamania |
1.55 |
Temperatura zapłonu |
93.8°C |
Ciśnienie pary |
0.0348mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|