ChemNet > CAS > 135306-45-5 3,5-difluoropropiophenone
135306-45-5 3,5-difluoropropiophenone
Nazwa produktu: |
3,5-difluoropropiophenone |
Angielska nazwa |
3,5-difluoropropiophenone; 1-(3,5-difluorophenyl)propan-1-one; 1-(3,5-difluorophenyl)propan-2-one |
MF |
C9H8F2O |
Masie cząsteczkowej |
170.156 |
InChI |
InChI=1/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
Nr CAS |
135306-45-5 |
Struktury molekularnej |
|
Gęstość |
1.179g/cm3 |
Temperatura topnienia |
25-27℃ |
Temperatura wrzenia |
191.5°C at 760 mmHg |
Współczynnik załamania |
1.472 |
Temperatura zapłonu |
70.6°C |
Ciśnienie pary |
0.513mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|