ChemNet > CAS > 13991-08-7 1,2-Bis(dimethylphosphino)benzene
13991-08-7 1,2-Bis(dimethylphosphino)benzene
Nazwa produktu: |
1,2-Bis(dimethylphosphino)benzene |
Angielska nazwa |
1,2-Bis(dimethylphosphino)benzene; 1,2-Bis(diphenylphosphino)benzene; benzene-1,2-diylbis(diphenylphosphane) |
MF |
C30H24P2 |
Masie cząsteczkowej |
446.4591 |
InChI |
InChI=1/C30H24P2/c1-5-15-25(16-6-1)31(26-17-7-2-8-18-26)29-23-13-14-24-30(29)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-24H |
Nr CAS |
13991-08-7 |
Struktury molekularnej |
|
Temperatura topnienia |
185-187℃ |
Temperatura wrzenia |
546.942°C at 760 mmHg |
Temperatura zapłonu |
302.787°C |
Ciśnienie pary |
0mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|