ChemNet > CAS > 145240-28-4 4-n-Butylbenzeneboronic acid
145240-28-4 4-n-Butylbenzeneboronic acid
Nazwa produktu: |
4-n-Butylbenzeneboronic acid |
Angielska nazwa |
4-n-Butylbenzeneboronic acid; 4-n-Butylphenylboronic acid; 4-Butylphenylboronic acid; (4-butylphenyl)boronic acid |
MF |
C10H15BO2 |
Masie cząsteczkowej |
178.0359 |
InChI |
InChI=1/C10H15BO2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8,12-13H,2-4H2,1H3 |
Nr CAS |
145240-28-4 |
Struktury molekularnej |
|
Gęstość |
1.03g/cm3 |
Temperatura topnienia |
91-97℃ |
Temperatura wrzenia |
313.5°C at 760 mmHg |
Współczynnik załamania |
1.512 |
Temperatura zapłonu |
143.4°C |
Ciśnienie pary |
0.00021mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|