ChemNet > CAS > 1460-18-0 1,15-Pentadecanedioic acid
1460-18-0 1,15-Pentadecanedioic acid
| Nazwa produktu: |
1,15-Pentadecanedioic acid |
| Angielska nazwa |
1,15-Pentadecanedioic acid; Pentadecanedioic acid |
| MF |
C15H28O4 |
| Masie cząsteczkowej |
272.3804 |
| InChI |
InChI=1/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19) |
| Nr CAS |
1460-18-0 |
| Struktury molekularnej |
|
| Gęstość |
1.026g/cm3 |
| Temperatura topnienia |
113-114℃ |
| Temperatura wrzenia |
445.8°C at 760 mmHg |
| Współczynnik załamania |
1.474 |
| Temperatura zapłonu |
237.5°C |
| Ciśnienie pary |
3.44E-09mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
