1466-88-2 o-Nitrocinnamaldehyde
Nazwa produktu: |
o-Nitrocinnamaldehyde |
Angielska nazwa |
o-Nitrocinnamaldehyde; 2-Nitrocinnamaldehyde; 3-(2-nitrophenyl)prop-2-enal; (2E)-3-(2-nitrophenyl)prop-2-enal |
MF |
C9H7NO3 |
Masie cząsteczkowej |
177.1568 |
InChI |
InChI=1/C9H7NO3/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-7H/b5-3+ |
Nr CAS |
1466-88-2 |
EINECS |
215-988-0 |
Struktury molekularnej |
|
Gęstość |
1.269g/cm3 |
Temperatura topnienia |
125-126℃ |
Temperatura wrzenia |
348.1°C at 760 mmHg |
Współczynnik załamania |
1.617 |
Temperatura zapłonu |
178.1°C |
Ciśnienie pary |
5.15E-05mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|