1492-30-4 4-nitrophenyl palmitate
Nazwa produktu: |
4-nitrophenyl palmitate |
Angielska nazwa |
4-nitrophenyl palmitate; 4-Nitrophenyl hexadecanoate; Palmitic acid 4-nitrophenyl ester; 4-Nitrophenol palmitate |
MF |
C22H35NO4 |
Masie cząsteczkowej |
377.5176 |
InChI |
InChI=1/C22H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22(24)27-21-18-16-20(17-19-21)23(25)26/h16-19H,2-15H2,1H3 |
Nr CAS |
1492-30-4 |
EINECS |
216-084-9 |
Struktury molekularnej |
|
Gęstość |
1.02g/cm3 |
Temperatura topnienia |
60℃ |
Temperatura wrzenia |
483.6°C at 760 mmHg |
Współczynnik załamania |
1.5 |
Temperatura zapłonu |
160.7°C |
Ciśnienie pary |
1.66E-09mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|