ChemNet > CAS > 1530-04-7 1,1-Diphenylhexane
1530-04-7 1,1-Diphenylhexane
| Nazwa produktu: |
1,1-Diphenylhexane |
| Angielska nazwa |
1,1-Diphenylhexane;1,1'-hexane-1,1-diyldibenzene |
| MF |
C18H22 |
| Masie cząsteczkowej |
238.3673 |
| InChI |
InChI=1/C18H22/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h4-5,7-14,18H,2-3,6,15H2,1H3 |
| Nr CAS |
1530-04-7 |
| Struktury molekularnej |
|
| Gęstość |
0.945g/cm3 |
| Temperatura wrzenia |
331.4°C at 760 mmHg |
| Współczynnik załamania |
1.536 |
| Temperatura zapłonu |
162.4°C |
| Ciśnienie pary |
0.000301mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
