ChemNet > CAS > 153195-01-8 (2-amino-5-etylo-3-tienyl) (4-metoksyfenylo)metanon
153195-01-8 (2-amino-5-etylo-3-tienyl) (4-metoksyfenylo)metanon
| Nazwa produktu: |
(2-amino-5-etylo-3-tienyl) (4-metoksyfenylo)metanon |
| Synonimy |
(2-amino-5-etylotiofen-3-yl) (4-metoksyfenylo)metanon |
| Angielska nazwa |
(2-amino-5-ethyl-3-thienyl)(4-methoxyphenyl)methanone;(2-amino-5-ethylthiophen-3-yl)(4-methoxyphenyl)methanone |
| MF |
C14H15NO2S |
| Masie cząsteczkowej |
261.3394 |
| InChI |
InChI=1/C14H15NO2S/c1-3-11-8-12(14(15)18-11)13(16)9-4-6-10(17-2)7-5-9/h4-8H,3,15H2,1-2H3 |
| Nr CAS |
153195-01-8 |
| Struktury molekularnej |
|
| Gęstość |
1.209g/cm3 |
| Temperatura topnienia |
100℃ |
| Temperatura wrzenia |
458.9°C at 760 mmHg |
| Współczynnik załamania |
1.609 |
| Temperatura zapłonu |
231.4°C |
| Ciśnienie pary |
1.32E-08mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
