ChemNet > CAS > 153435-96-2 4,6-dichloro-3-formylo-1H-indolo-2-karboksylan etylu
153435-96-2 4,6-dichloro-3-formylo-1H-indolo-2-karboksylan etylu
| Nazwa produktu: |
4,6-dichloro-3-formylo-1H-indolo-2-karboksylan etylu |
| Angielska nazwa |
ethyl 4,6-dichloro-3-formyl-1H-indole-2-carboxylate; |
| MF |
C12H9Cl2NO3 |
| Masie cząsteczkowej |
286.1108 |
| InChI |
InChI=1/C12H9Cl2NO3/c1-2-18-12(17)11-7(5-16)10-8(14)3-6(13)4-9(10)15-11/h3-5,15H,2H2,1H3 |
| Nr CAS |
153435-96-2 |
| Struktury molekularnej |
|
| Gęstość |
1.491g/cm3 |
| Temperatura topnienia |
214℃ |
| Temperatura wrzenia |
485.1°C at 760 mmHg |
| Współczynnik załamania |
1.667 |
| Temperatura zapłonu |
247.2°C |
| Ciśnienie pary |
1.45E-09mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
