ChemNet > CAS > 1539-04-4 Diphenyl tere-phthalate
1539-04-4 Diphenyl tere-phthalate
Nazwa produktu: |
Diphenyl tere-phthalate |
Angielska nazwa |
Diphenyl tere-phthalate; Diphenyl terephthalate; Terephthalic acid diphenyl ester; diphenyl benzene-1,4-dicarboxylate |
MF |
C20H14O4 |
Masie cząsteczkowej |
318.3228 |
InChI |
InChI=1/C20H14O4/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18/h1-14H |
Nr CAS |
1539-04-4 |
EINECS |
216-264-7 |
Struktury molekularnej |
|
Gęstość |
1.242g/cm3 |
Temperatura topnienia |
197-199℃ |
Temperatura wrzenia |
496.6°C at 760 mmHg |
Współczynnik załamania |
1.615 |
Temperatura zapłonu |
255°C |
Ciśnienie pary |
5.34E-10mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|