15518-68-0 Fast Blue BB salt
Nazwa produktu: |
Fast Blue BB salt |
Angielska nazwa |
Fast Blue BB salt; Azoic Diazo No. 20; 4-(phenylcarboxamido)-2,5-diethoxybenzenediazonium chloride; 4-(benzoylamino)-2,5-diethoxybenzenediazonium hexafluorophosphate; 2,5-diethoxy-4-[(phenylcarbonyl)amino]benzenediazonium chloride |
MF |
C17H18ClN3O3 |
Masie cząsteczkowej |
347.7961 |
InChI |
InChI=1/C17H17N3O3.ClH/c1-3-22-15-11-14(20-18)16(23-4-2)10-13(15)19-17(21)12-8-6-5-7-9-12;/h5-11H,3-4H2,1-2H3;1H |
Nr CAS |
15518-68-0 |
EINECS |
239-549-8 |
Struktury molekularnej |
|
Temperatura topnienia |
157℃ |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|