ChemNet > CAS > 15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
| Nazwa produktu: |
octanoic acid, compound with dicyclohexylamine (1:1) |
| Angielska nazwa |
octanoic acid, compound with dicyclohexylamine (1:1); Octanoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine caprylate; N-cyclohexylcyclohexanaminium octanoate |
| MF |
C20H39NO2 |
| Masie cząsteczkowej |
325.5292 |
| InChI |
InChI=1/C12H23N.C8H16O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7-8(9)10/h11-13H,1-10H2;2-7H2,1H3,(H,9,10) |
| Nr CAS |
15816-71-4 |
| EINECS |
239-914-1 |
| Struktury molekularnej |
|
| Temperatura wrzenia |
466.8°C at 760 mmHg |
| Temperatura zapłonu |
236.1°C |
| Ciśnienie pary |
5.25E-10mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
|
|
