ChemNet > CAS > 1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
Nazwa produktu: |
2,3,4,5,6-Pentafluorobenzeneboronic acid |
Angielska nazwa |
2,3,4,5,6-Pentafluorobenzeneboronic acid; 2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
MF |
C6H2BF5O2 |
Masie cząsteczkowej |
211.8819 |
InChI |
InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
Nr CAS |
1582-24-7 |
Struktury molekularnej |
|
Gęstość |
1.61g/cm3 |
Temperatura wrzenia |
244°C at 760 mmHg |
Współczynnik załamania |
1.429 |
Temperatura zapłonu |
101.4°C |
Ciśnienie pary |
0.0166mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|