ChemNet > CAS > 1591-30-6 4,4'-Biphenyldicarbonitrile
1591-30-6 4,4'-Biphenyldicarbonitrile
| Nazwa produktu: |
4,4'-Biphenyldicarbonitrile |
| Angielska nazwa |
4,4'-Biphenyldicarbonitrile; 4,4-Dicyanobiphenyl; biphenyl-4,4'-dicarbonitrile |
| MF |
C14H8N2 |
| Masie cząsteczkowej |
204.2267 |
| InChI |
InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
| Nr CAS |
1591-30-6 |
| EINECS |
216-468-6 |
| Struktury molekularnej |
|
| Gęstość |
1.2g/cm3 |
| Temperatura topnienia |
236-236℃ |
| Temperatura wrzenia |
403.5°C at 760 mmHg |
| Współczynnik załamania |
1.631 |
| Temperatura zapłonu |
199.2°C |
| Ciśnienie pary |
1.02E-06mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
