ChemNet > CAS > 163517-62-2 5-fluoro-2-methylphenylboronic acid
163517-62-2 5-fluoro-2-methylphenylboronic acid
Nazwa produktu: |
5-fluoro-2-methylphenylboronic acid |
Angielska nazwa |
5-fluoro-2-methylphenylboronic acid; 5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid; 5-Fluoro-2-methylbenzeneboronic acid |
MF |
C7H8BFO2 |
Masie cząsteczkowej |
153.9466 |
InChI |
InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3 |
Nr CAS |
163517-62-2 |
Struktury molekularnej |
|
Gęstość |
1.2g/cm3 |
Temperatura wrzenia |
287.7°C at 760 mmHg |
Współczynnik załamania |
1.505 |
Temperatura zapłonu |
127.8°C |
Ciśnienie pary |
0.00113mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|