ChemNet > CAS > 1667-01-2 2',4',6'-Trimethylacetophenone
1667-01-2 2',4',6'-Trimethylacetophenone
Nazwa produktu: |
2',4',6'-Trimethylacetophenone |
Angielska nazwa |
2',4',6'-Trimethylacetophenone; 2-Acetylmesitylene; 2,4,6-Trimethylacetophenone; 1-(2,4,6-trimethylphenyl)ethanone |
MF |
C11H14O |
Masie cząsteczkowej |
162.2283 |
InChI |
InChI=1/C11H14O/c1-7-5-8(2)11(10(4)12)9(3)6-7/h5-6H,1-4H3 |
Nr CAS |
1667-01-2 |
EINECS |
216-783-9 |
Struktury molekularnej |
|
Gęstość |
0.955g/cm3 |
Temperatura wrzenia |
250.2°C at 760 mmHg |
Współczynnik załamania |
1.509 |
Temperatura zapłonu |
99°C |
Ciśnienie pary |
0.022mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|