ChemNet > CAS > 16718-11-9 3-(Phenylthio)thiophene
16718-11-9 3-(Phenylthio)thiophene
Nazwa produktu: |
3-(Phenylthio)thiophene |
Angielska nazwa |
3-(Phenylthio)thiophene; Phenyl 3-thienyl sulphide; 3-(phenylsulfanyl)thiophene |
MF |
C10H8S2 |
Masie cząsteczkowej |
192.3005 |
InChI |
InChI=1/C10H8S2/c1-2-4-9(5-3-1)12-10-6-7-11-8-10/h1-8H |
Nr CAS |
16718-11-9 |
Struktury molekularnej |
|
Gęstość |
1.24g/cm3 |
Temperatura wrzenia |
304.7°C at 760 mmHg |
Współczynnik załamania |
1.667 |
Temperatura zapłonu |
138.1°C |
Ciśnienie pary |
0.00155mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|