ChemNet > CAS > 16718-12-0 2-(Phenylthio)thiophene
16718-12-0 2-(Phenylthio)thiophene
| Nazwa produktu: |
2-(Phenylthio)thiophene |
| Angielska nazwa |
2-(Phenylthio)thiophene; Phenyl 2-thienyl sulphide; 2-(phenylsulfanyl)thiophene; 2-(phenylthio)-thiophene |
| MF |
C10H8S2 |
| Masie cząsteczkowej |
192.3005 |
| InChI |
InChI=1/C10H8S2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
| Nr CAS |
16718-12-0 |
| Struktury molekularnej |
|
| Gęstość |
1.24g/cm3 |
| Temperatura wrzenia |
304.7°C at 760 mmHg |
| Współczynnik załamania |
1.667 |
| Temperatura zapłonu |
138.1°C |
| Ciśnienie pary |
0.00155mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
