ChemNet > CAS > 1674-30-2 2-chloro-1-phenylethanol
1674-30-2 2-chloro-1-phenylethanol
| Nazwa produktu: |
2-chloro-1-phenylethanol |
| Angielska nazwa |
2-chloro-1-phenylethanol; styrene chlorohydrin; [2-(chloromethyl)phenyl]methanol |
| MF |
C8H9ClO |
| Masie cząsteczkowej |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6H2 |
| Nr CAS |
1674-30-2 |
| EINECS |
216-816-7 |
| Struktury molekularnej |
|
| Gęstość |
1.196g/cm3 |
| Temperatura wrzenia |
267.289°C at 760 mmHg |
| Współczynnik załamania |
1.562 |
| Temperatura zapłonu |
119.526°C |
| Ciśnienie pary |
0.004mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
