ChemNet > CAS > 17126-62-4 Ethyl 3-isothiocyanatopropionate
17126-62-4 Ethyl 3-isothiocyanatopropionate
| Nazwa produktu: |
Ethyl 3-isothiocyanatopropionate |
| Angielska nazwa |
Ethyl 3-isothiocyanatopropionate; 3-Isothiocyanatopropionic acid ethyl ester; ethyl N-(thioxomethylidene)-beta-alaninate |
| MF |
C6H9NO2S |
| Masie cząsteczkowej |
159.2062 |
| InChI |
InChI=1/C6H9NO2S/c1-2-9-6(8)3-4-7-5-10/h2-4H2,1H3 |
| Nr CAS |
17126-62-4 |
| Struktury molekularnej |
|
| Gęstość |
1.09g/cm3 |
| Temperatura wrzenia |
242.9°C at 760 mmHg |
| Współczynnik załamania |
1.498 |
| Temperatura zapłonu |
100.7°C |
| Ciśnienie pary |
0.033mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
