ChemNet > CAS > 175277-49-3 6-methoxypyridine-3-carbothioamide
175277-49-3 6-methoxypyridine-3-carbothioamide
Nazwa produktu: |
6-methoxypyridine-3-carbothioamide |
Angielska nazwa |
6-methoxypyridine-3-carbothioamide; 6-methoxy-3-Pyridinecarbothioamide |
MF |
C7H8N2OS |
Masie cząsteczkowej |
168.2162 |
InChI |
InChI=1/C7H8N2OS/c1-10-6-3-2-5(4-9-6)7(8)11/h2-4H,1H3,(H2,8,11) |
Nr CAS |
175277-49-3 |
Struktury molekularnej |
|
Gęstość |
1.262g/cm3 |
Temperatura topnienia |
150℃ |
Temperatura wrzenia |
292.5°C at 760 mmHg |
Współczynnik załamania |
1.626 |
Temperatura zapłonu |
130.7°C |
Ciśnienie pary |
0.00183mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|