ChemNet > CAS > 17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
Nazwa produktu: |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
Angielska nazwa |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one;3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
MF |
C8H11ClO |
Masie cząsteczkowej |
158.6253 |
InChI |
InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
Nr CAS |
17530-69-7 |
Struktury molekularnej |
|
Gęstość |
1.09g/cm3 |
Temperatura wrzenia |
217.7°C at 760 mmHg |
Współczynnik załamania |
1.488 |
Temperatura zapłonu |
104.8°C |
Ciśnienie pary |
0.131mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|