ChemNet > CAS > 17740-40-8 diethyl 1-benzylpyrrolidine-2,5-dicarboxylate
17740-40-8 diethyl 1-benzylpyrrolidine-2,5-dicarboxylate
| Nazwa produktu: |
diethyl 1-benzylpyrrolidine-2,5-dicarboxylate |
| Angielska nazwa |
diethyl 1-benzylpyrrolidine-2,5-dicarboxylate; |
| MF |
C17H23NO4 |
| Masie cząsteczkowej |
305.3688 |
| InChI |
InChI=1/C17H23NO4/c1-3-21-16(19)14-10-11-15(17(20)22-4-2)18(14)12-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3 |
| Nr CAS |
17740-40-8 |
| Struktury molekularnej |
|
| Gęstość |
1.146g/cm3 |
| Temperatura wrzenia |
381.3°C at 760 mmHg |
| Współczynnik załamania |
1.53 |
| Temperatura zapłonu |
184.4°C |
| Ciśnienie pary |
5.14E-06mmHg at 25°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
