ChemNet > CAS > 182482-25-3 2,4,6-Trifluorobenzeneboronic acid
182482-25-3 2,4,6-Trifluorobenzeneboronic acid
Nazwa produktu: |
2,4,6-Trifluorobenzeneboronic acid |
Angielska nazwa |
2,4,6-Trifluorobenzeneboronic acid; 2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
MF |
C6H4BF3O2 |
Masie cząsteczkowej |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
Nr CAS |
182482-25-3 |
Struktury molekularnej |
|
Gęstość |
1.44g/cm3 |
Temperatura topnienia |
228-235℃ |
Temperatura wrzenia |
266°C at 760 mmHg |
Współczynnik załamania |
1.465 |
Temperatura zapłonu |
114.6°C |
Ciśnienie pary |
0.00444mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|