ChemNet > CAS > 183158-34-1 2,3-Dimethylbenzeneboronic acid
183158-34-1 2,3-Dimethylbenzeneboronic acid
Nazwa produktu: |
2,3-Dimethylbenzeneboronic acid |
Angielska nazwa |
2,3-Dimethylbenzeneboronic acid; 2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
MF |
C8H11BO2 |
Masie cząsteczkowej |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
Nr CAS |
183158-34-1 |
Struktury molekularnej |
|
Gęstość |
1.07g/cm3 |
Temperatura topnienia |
174-180℃ |
Temperatura wrzenia |
312.6°C at 760 mmHg |
Współczynnik załamania |
1.523 |
Temperatura zapłonu |
142.8°C |
Ciśnienie pary |
0.000224mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|