ChemNet > CAS > 185243-69-0 Białko fuzyjne TNFR-Fc
185243-69-0 Białko fuzyjne TNFR-Fc
| Nazwa produktu: |
Białko fuzyjne TNFR-Fc |
| Synonimy |
Etanercept [USAN]; 1-235-Białko fuzyjne receptora czynnika martwicy nowotworu (ludzkiego) z 236-467-immunoglobuliną G1 (ludzki fragment łańcucha gamma1-Fc), dimer; Enbrel; Etanercept; Rekombinowany ludzki TNF; Rekombinowane ludzkie białko fuzyjne o dimerycznym receptorze TNF typu II-IgG; białko fuzyjne receptora TNF typu II-IgG; TNFR-Fc; TNFR:Fc; TNR 001; UNII-OP401G7OJC; rhu TNFR:Fc; 1-235-Białko fuzyjne receptora czynnika martwicy nowotworu (ludzkiego) z 236-467-immunoglobuliną G1 (ludzki fragment łańcucha gamma1-Fc); diazotan (2R,3S)-3,4-bis(nitrooksy)butano-1,2-diylu |
| Angielska nazwa |
TNFR-Fc fusion protein;Etanercept [USAN]; 1-235-Tumor necrosis factor receptor (human) fusion protein with 236-467-immunoglobulin G1 (human gamma1-chain Fc fragment), dimer; Enbrel; Etanercept; Recombinant human TNF; Recombinant human dimeric TNF receptor type II-IgG fusion protein; TNF receptor type II-IgG fusion protein; TNFR-Fc; TNFR:Fc; TNR 001; UNII-OP401G7OJC; rhu TNFR:Fc; 1-235-Tumor necrosis factor receptor (human) fusion protein with 236-467-immunoglobulin G1 (human gamma1-chain Fc fragment); (2R,3S)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate |
| MF |
C4H6N4O12 |
| Masie cząsteczkowej |
302.11 |
| InChI |
InChI=1/C4H6N4O12/c9-5(10)17-1-3(19-7(13)14)4(20-8(15)16)2-18-6(11)12/h3-4H,1-2H2/t3-,4+ |
| Nr CAS |
185243-69-0 |
| EINECS |
230-734-9 |
| Struktury molekularnej |
|
| Gęstość |
1.757g/cm3 |
| Temperatura wrzenia |
381.8°C at 760 mmHg |
| Współczynnik załamania |
1.511 |
| Temperatura zapłonu |
178.8°C |
| Ciśnienie pary |
1.09E-05mmHg at 25°C |
|