ChemNet > CAS > 18937-79-6 Methyl 2-hexynoate
18937-79-6 Methyl 2-hexynoate
| Nazwa produktu: |
Methyl 2-hexynoate |
| Angielska nazwa |
Methyl 2-hexynoate; 2-Hexynoic acid methyl ester; methyl hex-2-ynoate |
| MF |
C7H10O2 |
| Masie cząsteczkowej |
126.1531 |
| InChI |
InChI=1/C7H10O2/c1-3-4-5-6-7(8)9-2/h3-4H2,1-2H3 |
| Nr CAS |
18937-79-6 |
| EINECS |
242-690-8 |
| Struktury molekularnej |
|
| Gęstość |
0.963g/cm3 |
| Temperatura wrzenia |
184.4°C at 760 mmHg |
| Współczynnik załamania |
1.436 |
| Temperatura zapłonu |
65.4°C |
| Ciśnienie pary |
0.734mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
