ChemNet > CAS > 18984-21-9 2,4-Dichloro-beta-nitrostyrene
18984-21-9 2,4-Dichloro-beta-nitrostyrene
| Nazwa produktu: |
2,4-Dichloro-beta-nitrostyrene |
| Angielska nazwa |
2,4-Dichloro-beta-nitrostyrene; 1-(2,4-Dichlorophenyl)-2-nitroethene; 2,4-dichloro-1-(2-nitroethenyl)benzene; 2,4-dichloro-1-[(E)-2-nitroethenyl]benzene |
| MF |
C8H5Cl2NO2 |
| Masie cząsteczkowej |
218.0368 |
| InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ |
| Nr CAS |
18984-21-9 |
| Struktury molekularnej |
|
| Gęstość |
1.447g/cm3 |
| Temperatura wrzenia |
334.1°C at 760 mmHg |
| Współczynnik załamania |
1.626 |
| Temperatura zapłonu |
155.9°C |
| Ciśnienie pary |
0.000253mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
