ChemNet > CAS > 19056-40-7 4-Bromo-3-methoxyaniline
19056-40-7 4-Bromo-3-methoxyaniline
Nazwa produktu: |
4-Bromo-3-methoxyaniline |
Angielska nazwa |
4-Bromo-3-methoxyaniline; 4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine; 5-Amino-2-bromoanisole |
MF |
C13H10N2O4 |
Masie cząsteczkowej |
258.2295 |
InChI |
InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
Nr CAS |
19056-40-7 |
Struktury molekularnej |
|
Gęstość |
1.381g/cm3 |
Temperatura wrzenia |
467°C at 760 mmHg |
Współczynnik załamania |
1.655 |
Temperatura zapłonu |
236.2°C |
Ciśnienie pary |
6.74E-09mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|