ChemNet > CAS > 1912-43-2 2-methyl-3-indoleacetic acid
1912-43-2 2-methyl-3-indoleacetic acid
Nazwa produktu: |
2-methyl-3-indoleacetic acid |
Angielska nazwa |
2-methyl-3-indoleacetic acid; 2-Methylindole-3-acetic acid; (2-methyl-1H-indol-3-yl)acetic acid |
MF |
C11H11NO2 |
Masie cząsteczkowej |
189.2026 |
InChI |
InChI=1/C11H11NO2/c1-7-9(6-11(13)14)8-4-2-3-5-10(8)12-7/h2-5,12H,6H2,1H3,(H,13,14) |
Nr CAS |
1912-43-2 |
Struktury molekularnej |
|
Temperatura topnienia |
205℃ |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|